CAS 100959-22-6 appears in our catalog under these names: Methyl 2–Bromo–4–nitrobenzoate, Methyl 2-Bromo-4-nitrobenzoate, >98.0%(GC), Methyl 2-bromo-4-nitrobenzoate 97%, METHYL 2-BROMO-4-NITROBENZOATE, 97%, 97%, Methyl 2-Bromo-4-nitrobenzoate, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 500g, 1g, 5g, 1000g, 50g.
Methyl 2-bromo-4-nitrobenzoate (CAS 100959-22-6) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 2-bromo-4-nitrobenzoate. InChIKey: XYMZAFDNPJLOTP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 2-bromo-4-nitrobenzoate |
| InChIKey | XYMZAFDNPJLOTP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)