Products 10098-39-2
CAS 10098-39-2 is the registry number for 2-Hydroxy-2-(4-nitrophenyl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
2-hydroxy-2-(4-nitrophenyl)acetic acid (CAS 10098-39-2) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 2-hydroxy-2-(4-nitrophenyl)acetic acid. InChIKey: ZSMJZVLXJDNZHG-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-hydroxy-2-(4-nitrophenyl)acetic acid |
| InChIKey | ZSMJZVLXJDNZHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
p-nitromandelic acid, 2-hydroxy-2-(4-nitrophenyl)acetic acid, 4-Nitrophenylglycolic acid, Benzeneacetic acid, alpha-hydroxy-4-nitro-, hydroxy{4-nitrophenyl}acetic acid, 4-nitromandelic acid, p-nitro-mandelic acid, alpha-Hydroxy-4-nitrobenzeneacetic acid, Benzeneacetic acid, a-hydroxy-4-nitro-, (R)-4-Nitromandelic