Products 101-10-0
CAS 101-10-0 appears in our catalog under these names: 2-(3-Chlorophenoxy)propionic acid, 98%, Cloprop, 2–(3–Chlorophenoxy)propionic acid, 2-(3-Chlorophenoxy)propionic Acid, >98.0%(T), Cloprop, Concentration: 10.0 µg/ml Solvent: Acetonitrile. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 25g, 500g, 100g, 5g, 100mg, 50G, 1x100mg, 1x10ml.
2-(3-chlorophenoxy)propanoic acid (CAS 101-10-0) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(3-chlorophenoxy)propanoic acid. InChIKey: YNTJKQDWYXUTLZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(3-chlorophenoxy)propanoic acid |
| InChIKey | YNTJKQDWYXUTLZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)