Products 1010422-50-0
CAS 1010422-50-0 is the registry number for 2-bromo-1-methoxy-3-(trifluoromethoxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-bromo-1-methoxy-3-(trifluoromethoxy)benzene (CAS 1010422-50-0) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: 2-bromo-1-methoxy-3-(trifluoromethoxy)benzene. InChIKey: DGEDLRNQSAJFMU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-3-(trifluoromethoxy)benzene |
| InChIKey | DGEDLRNQSAJFMU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)