Products 101046-57-5

CAS 101046-57-5 is the registry number for Ethyl 2-((4-chlorophenoxy)methyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-[(4-chlorophenoxy)methyl]prop-2-enoate (CAS 101046-57-5) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: ethyl 2-[(4-chlorophenoxy)methyl]prop-2-enoate. InChIKey: NPRHZIHNFIZGGG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClO3
Molecular weight240.68 g/mol
IUPAC nameethyl 2-[(4-chlorophenoxy)methyl]prop-2-enoate
InChIKeyNPRHZIHNFIZGGG-UHFFFAOYSA-N
SMILESCCOC(=O)C(=C)COC1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)