CAS 1010882-44-6 is the registry number for 4-(2-Fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-3h-imidazo[4,5-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(2-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (CAS 1010882-44-6) is a chemical compound with the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. IUPAC name: 4-(2-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine. InChIKey: IJBBWLLIWZYCNK-UHFFFAOYSA-N.
| Molecular formula | C13H14FN3O |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 4-(2-fluoro-4-methoxyphenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
| InChIKey | IJBBWLLIWZYCNK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2C3=C(CCN2)NC=N3)F |
Computed by PubChem (NCBI)