CAS 380474-18-0 appears in our catalog under these names: 1-(4-Fluoro-phenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid hydrazide, 95%, 1-(4-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbohydrazide, 95%, 1-(4-Fluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide (CAS 380474-18-0) is a chemical compound with the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide. InChIKey: WKYACYFAJSKXRU-UHFFFAOYSA-N.
| Molecular formula | C13H14FN3O |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbohydrazide |
| InChIKey | WKYACYFAJSKXRU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)F)C)C(=O)NN |
Computed by PubChem (NCBI)