Products 1154345-08-0
CAS 1154345-08-0 appears in our catalog under these names: 2-[3-(3-Fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidine, 90%, 2-[3-(3-Fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidine hydrochloride, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(3-fluorophenyl)-5-piperidin-2-yl-1,2,4-oxadiazole (CAS 1154345-08-0) is a chemical compound with the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. IUPAC name: 3-(3-fluorophenyl)-5-piperidin-2-yl-1,2,4-oxadiazole. InChIKey: KBBZWQAPDQFBEM-UHFFFAOYSA-N.
| Molecular formula | C13H14FN3O |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
| InChIKey | KBBZWQAPDQFBEM-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=NC(=NO2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)