Products 1240663-00-6
CAS 1240663-00-6 is the registry number for 2-((2-Cyano-3-fluorophenyl)(methyl)amino)-N-cyclopropylacetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-cyano-3-fluoro-N-methylanilino)-N-cyclopropylacetamide (CAS 1240663-00-6) is a chemical compound with the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. IUPAC name: 2-(2-cyano-3-fluoro-N-methylanilino)-N-cyclopropylacetamide. InChIKey: SIAAJHOQRJNADR-UHFFFAOYSA-N.
| Molecular formula | C13H14FN3O |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(2-cyano-3-fluoro-N-methylanilino)-N-cyclopropylacetamide |
| InChIKey | SIAAJHOQRJNADR-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)NC1CC1)C2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)