CAS 1707580-74-2 is the registry number for 2–(4–Fluorophenyl)–1,3,8–triazaspiro(4·5)dec–1–en–4–one. Offered by: GLPBio. Available pack sizes: 1g.
2-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (CAS 1707580-74-2) is a chemical compound with the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one. InChIKey: IGAKKLUBDXRWOO-UHFFFAOYSA-N.
| Molecular formula | C13H14FN3O |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| InChIKey | IGAKKLUBDXRWOO-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C(=O)NC(=N2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)