CAS 10109-76-9 appears in our catalog under these names: Dienogest Impurity 3, 3,3-Dimethoxyestra-5(10),9(11)-dien-17-one, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
(8S,13S,14S)-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (CAS 10109-76-9) is a chemical compound with the molecular formula C20H28O3 and a molecular weight of 316.4 g/mol. IUPAC name: (8S,13S,14S)-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one. InChIKey: YEOAIJNHLPFTRM-AOIWGVFYSA-N.
| Molecular formula | C20H28O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (8S,13S,14S)-3,3-dimethoxy-13-methyl-1,2,4,6,7,8,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | YEOAIJNHLPFTRM-AOIWGVFYSA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CCC2=O)CCC4=C3CCC(C4)(OC)OC |
Computed by PubChem (NCBI)