CAS 101094-05-7 is the registry number for Modafinil Acid Sulfone. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzhydrylsulfonylacetic acid (CAS 101094-05-7) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: 2-benzhydrylsulfonylacetic acid. InChIKey: XTXZDQKYJIHOMB-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-benzhydrylsulfonylacetic acid |
| InChIKey | XTXZDQKYJIHOMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)