Products 64101-67-3

CAS 64101-67-3 is the registry number for 4-Acetylphenyl p-toluenesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

(4-acetylphenyl) 4-methylbenzenesulfonate (CAS 64101-67-3) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: (4-acetylphenyl) 4-methylbenzenesulfonate. InChIKey: SRXCBGBYJGNHOS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O4S
Molecular weight290.3 g/mol
IUPAC name(4-acetylphenyl) 4-methylbenzenesulfonate
InChIKeySRXCBGBYJGNHOS-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC2=CC=C(C=C2)C(=O)C

Computed by PubChem (NCBI)