CAS 64101-67-3 is the registry number for 4-Acetylphenyl p-toluenesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
(4-acetylphenyl) 4-methylbenzenesulfonate (CAS 64101-67-3) is a chemical compound with the molecular formula C15H14O4S and a molecular weight of 290.3 g/mol. IUPAC name: (4-acetylphenyl) 4-methylbenzenesulfonate. InChIKey: SRXCBGBYJGNHOS-UHFFFAOYSA-N.
| Molecular formula | C15H14O4S |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | (4-acetylphenyl) 4-methylbenzenesulfonate |
| InChIKey | SRXCBGBYJGNHOS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)