CAS 1248957-71-2 appears in our catalog under these names: 5-Methyl-1-((3-methyl-1,2-oxazol-5-yl)methyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Methyl-1-((3-methyl-1,2-oxazol-5-yl)methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]triazole-4-carboxylic acid (CAS 1248957-71-2) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: 5-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]triazole-4-carboxylic acid. InChIKey: PPXRDYSHLFQKGM-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 5-methyl-1-[(3-methyl-1,2-oxazol-5-yl)methyl]triazole-4-carboxylic acid |
| InChIKey | PPXRDYSHLFQKGM-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)CN2C(=C(N=N2)C(=O)O)C |
Computed by PubChem (NCBI)