CAS 1011398-78-9 is the registry number for 2-{3-Methyl-5-nitro-1H-pyrazolo(3,4-b)pyridin-1-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-methyl-5-nitropyrazolo[5,4-b]pyridin-1-yl)acetic acid (CAS 1011398-78-9) is a chemical compound with the molecular formula C9H8N4O4 and a molecular weight of 236.18 g/mol. IUPAC name: 2-(3-methyl-5-nitropyrazolo[5,4-b]pyridin-1-yl)acetic acid. InChIKey: IPVSVIAJDSJJJJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O4 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 2-(3-methyl-5-nitropyrazolo[5,4-b]pyridin-1-yl)acetic acid |
| InChIKey | IPVSVIAJDSJJJJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)