Products 1011398-78-9

CAS 1011398-78-9 is the registry number for 2-{3-Methyl-5-nitro-1H-pyrazolo(3,4-b)pyridin-1-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(3-methyl-5-nitropyrazolo[5,4-b]pyridin-1-yl)acetic acid (CAS 1011398-78-9) is a chemical compound with the molecular formula C9H8N4O4 and a molecular weight of 236.18 g/mol. IUPAC name: 2-(3-methyl-5-nitropyrazolo[5,4-b]pyridin-1-yl)acetic acid. InChIKey: IPVSVIAJDSJJJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N4O4
Molecular weight236.18 g/mol
IUPAC name2-(3-methyl-5-nitropyrazolo[5,4-b]pyridin-1-yl)acetic acid
InChIKeyIPVSVIAJDSJJJJ-UHFFFAOYSA-N
SMILESCC1=NN(C2=C1C=C(C=N2)[N+](=O)[O-])CC(=O)O

Computed by PubChem (NCBI)