Products 2441945-94-2
CAS 2441945-94-2 is the registry number for Ethyl 6-nitro-1H-imidazo[4,5-b]pyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-nitro-1H-imidazo[4,5-b]pyridine-2-carboxylate (CAS 2441945-94-2) is a chemical compound with the molecular formula C9H8N4O4 and a molecular weight of 236.18 g/mol. IUPAC name: ethyl 6-nitro-1H-imidazo[4,5-b]pyridine-2-carboxylate. InChIKey: MWZMKTOZDKMXRS-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O4 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | ethyl 6-nitro-1H-imidazo[4,5-b]pyridine-2-carboxylate |
| InChIKey | MWZMKTOZDKMXRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N1)C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)