Products 259824-62-9
CAS 259824-62-9 appears in our catalog under these names: Acrolein 2,4-Dinitrophenylhydrazone-d3, Acrolein 2,4-Dinitrophenylhydrazone-3,5,6-d3, 99 atom % D, min 98% Chemical Purity, Acrolein 2,4–dinitrophenylhydrazone–3,5,6–d3, Acrolein 2,4-dinitrophenylhydrazone-3,5,6-d3, 99.95%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
2,3,5-trideuterio-4,6-dinitro-N-[(E)-prop-2-enylideneamino]aniline (CAS 259824-62-9) is a chemical compound with the molecular formula C9H8N4O4 and a molecular weight of 239.20 g/mol. IUPAC name: 2,3,5-trideuterio-4,6-dinitro-N-[(E)-prop-2-enylideneamino]aniline. InChIKey: JJPZHGIYUVFTGG-GYFHQMESSA-N.
| Molecular formula | C9H8N4O4 |
|---|---|
| Molecular weight | 239.20 g/mol |
| IUPAC name | 2,3,5-trideuterio-4,6-dinitro-N-[(E)-prop-2-enylideneamino]aniline |
| InChIKey | JJPZHGIYUVFTGG-GYFHQMESSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N/N=C/C=C)[N+](=O)[O-])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)