CAS 888-54-0 appears in our catalog under these names: Acrolein 2,4-Dinitrophenylhydrazone, Acrolein-2,4-dinitrophenylhydrazone, Acrolein–DNPH solution, Acrolein-2,4-DNPH, ACROLEIN-DNPH, 1X1ML, 1000UG/ML,&. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 25mg, 1,2ml, 0,5g, 0,25g, 1g, 2g, 5g.
2,4-dinitro-N-[(E)-prop-2-enylideneamino]aniline (CAS 888-54-0) is a chemical compound with the molecular formula C9H8N4O4 and a molecular weight of 236.18 g/mol. IUPAC name: 2,4-dinitro-N-[(E)-prop-2-enylideneamino]aniline. InChIKey: JJPZHGIYUVFTGG-BJMVGYQFSA-N.
| Molecular formula | C9H8N4O4 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 2,4-dinitro-N-[(E)-prop-2-enylideneamino]aniline |
| InChIKey | JJPZHGIYUVFTGG-BJMVGYQFSA-N |
| SMILES | C=C/C=N/NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)