Products 2610635-91-9
CAS 2610635-91-9 is the registry number for 1,1'-Methylenebis(1H-pyrazole-4-carboxylic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(4-carboxypyrazol-1-yl)methyl]pyrazole-4-carboxylic acid (CAS 2610635-91-9) is a chemical compound with the molecular formula C9H8N4O4 and a molecular weight of 236.18 g/mol. IUPAC name: 1-[(4-carboxypyrazol-1-yl)methyl]pyrazole-4-carboxylic acid. InChIKey: PVPYWDMLLOQXIY-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O4 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 1-[(4-carboxypyrazol-1-yl)methyl]pyrazole-4-carboxylic acid |
| InChIKey | PVPYWDMLLOQXIY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CN2C=C(C=N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)