Products 101197-99-3
CAS 101197-99-3 is the registry number for Acitemate. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(6S,9S)-3-ethoxycarbonyl-6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]acetic acid (CAS 101197-99-3) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: 2-[(6S,9S)-3-ethoxycarbonyl-6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]acetic acid. InChIKey: IRGLQUMAHASUTG-IUCAKERBSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2-[(6S,9S)-3-ethoxycarbonyl-6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-9-yl]acetic acid |
| InChIKey | IRGLQUMAHASUTG-IUCAKERBSA-N |
| SMILES | CCOC(=O)C1=CN=C2[C@@H](CC[C@@H](N2C1=O)C)CC(=O)O |
Computed by PubChem (NCBI)