CAS 1012-81-3 is the registry number for 1-(2-Aminophenyl)pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(2-aminophenyl)pyrrolidine-2,5-dione (CAS 1012-81-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1-(2-aminophenyl)pyrrolidine-2,5-dione. InChIKey: AKFYFUDAHYYAPB-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-(2-aminophenyl)pyrrolidine-2,5-dione |
| InChIKey | AKFYFUDAHYYAPB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)