Products 1012065-50-7
CAS 1012065-50-7 appears in our catalog under these names: Trans-4-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 96%, Cis-4-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
(3R,4S)-4-methoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1012065-50-7) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (3R,4S)-4-methoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: MAWAGXKOVLDPQH-CRCLSJGQSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (3R,4S)-4-methoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | MAWAGXKOVLDPQH-CRCLSJGQSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)