CAS 84211-45-0 is the registry number for 2,4-Cis-piperidine-2,4-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2S,4R)-piperidine-2,4-dicarboxylic acid (CAS 84211-45-0) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2S,4R)-piperidine-2,4-dicarboxylic acid. InChIKey: WXUOEIRUBILDKO-UHNVWZDZSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (2S,4R)-piperidine-2,4-dicarboxylic acid |
| InChIKey | WXUOEIRUBILDKO-UHNVWZDZSA-N |
| SMILES | C1CN[C@@H](C[C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)