Products 84211-45-0

CAS 84211-45-0 is the registry number for 2,4-Cis-piperidine-2,4-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2S,4R)-piperidine-2,4-dicarboxylic acid (CAS 84211-45-0) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2S,4R)-piperidine-2,4-dicarboxylic acid. InChIKey: WXUOEIRUBILDKO-UHNVWZDZSA-N.

Identity
Molecular formulaC7H11NO4
Molecular weight173.17 g/mol
IUPAC name(2S,4R)-piperidine-2,4-dicarboxylic acid
InChIKeyWXUOEIRUBILDKO-UHNVWZDZSA-N
SMILESC1CN[C@@H](C[C@@H]1C(=O)O)C(=O)O

Computed by PubChem (NCBI)