Products 59234-40-1
CAS 59234-40-1 appears in our catalog under these names: Cis-2,6-piperidine dicarboxylic acid, 95%, Cis–piperidine–2，6–dicarboxylic acid, Cis-piperidine-2,6-dicarboxylic acid 97%, cis-2,6-Piperidinedicarboxylic acid, 97%, 97%, (2R,6S)-Piperidine-2,6-dicarboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S,6R)-piperidine-2,6-dicarboxylic acid (CAS 59234-40-1) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2S,6R)-piperidine-2,6-dicarboxylic acid. InChIKey: SOOPBZRXJMNXTF-SYDPRGILSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (2S,6R)-piperidine-2,6-dicarboxylic acid |
| InChIKey | SOOPBZRXJMNXTF-SYDPRGILSA-N |
| SMILES | C1C[C@@H](N[C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)