CAS 46026-75-9 appears in our catalog under these names: (2R,3S)-Rel-piperidine-2,3-dicarboxylic acid, 95%, cis–2,3–piperidinedicarboxylic acid, cis-PDA, cis–Piperidine–2,3–dicarboxylic acid, 2,3-cis-Piperidinedicarboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 10mg, 25mg, 5mg.
(2S,3R)-piperidine-2,3-dicarboxylic acid (CAS 46026-75-9) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2S,3R)-piperidine-2,3-dicarboxylic acid. InChIKey: PTLWNCBCBZZBJI-UHNVWZDZSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (2S,3R)-piperidine-2,3-dicarboxylic acid |
| InChIKey | PTLWNCBCBZZBJI-UHNVWZDZSA-N |
| SMILES | C1C[C@H]([C@H](NC1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)