Products 43094-95-7

CAS 43094-95-7 is the registry number for 1-(2-Hydroxyethyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 43094-95-7) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: 1-(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: LYORUPRFHVMNOI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO4
Molecular weight173.17 g/mol
IUPAC name1-(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyLYORUPRFHVMNOI-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)CCO)C(=O)O

Computed by PubChem (NCBI)