CAS 101220-38-6 is the registry number for 3-(4-nitrophenyl)-2-(phenylcarbonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(Z)-2-benzoyl-3-(4-nitrophenyl)prop-2-enenitrile (CAS 101220-38-6) is a chemical compound with the molecular formula C16H10N2O3 and a molecular weight of 278.26 g/mol. IUPAC name: (Z)-2-benzoyl-3-(4-nitrophenyl)prop-2-enenitrile. InChIKey: QEXDYRFTUMHTEQ-UVTDQMKNSA-N.
| Molecular formula | C16H10N2O3 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (Z)-2-benzoyl-3-(4-nitrophenyl)prop-2-enenitrile |
| InChIKey | QEXDYRFTUMHTEQ-UVTDQMKNSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C(=C\C2=CC=C(C=C2)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)