Products 84133-31-3
CAS 84133-31-3 is the registry number for Methyl 6-oxo-6H-indolo[3,2,1-de][1,5]naphthyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate (CAS 84133-31-3) is a chemical compound with the molecular formula C16H10N2O3 and a molecular weight of 278.26 g/mol. IUPAC name: methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate. InChIKey: XQXQAMBHZZKHOL-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O3 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate |
| InChIKey | XQXQAMBHZZKHOL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C3C(=C1)C4=CC=CC=C4N3C(=O)C=C2 |
Computed by PubChem (NCBI)