Products 449737-26-2
CAS 449737-26-2 is the registry number for 2-(4-(1,3-Dioxoisoindolin-2-yl)phenoxy)acetonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]acetonitrile (CAS 449737-26-2) is a chemical compound with the molecular formula C16H10N2O3 and a molecular weight of 278.26 g/mol. IUPAC name: 2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]acetonitrile. InChIKey: BERIBIGCNUFYOC-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O3 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 2-[4-(1,3-dioxoisoindol-2-yl)phenoxy]acetonitrile |
| InChIKey | BERIBIGCNUFYOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=C(C=C3)OCC#N |
Computed by PubChem (NCBI)