Products 1204648-91-8
CAS 1204648-91-8 is the registry number for 9-Methoxyindolo[2,1-b]quinazoline-6,12-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-methoxyindolo[2,1-b]quinazoline-6,12-dione (CAS 1204648-91-8) is a chemical compound with the molecular formula C16H10N2O3 and a molecular weight of 278.26 g/mol. IUPAC name: 9-methoxyindolo[2,1-b]quinazoline-6,12-dione. InChIKey: DRPLTQKGAWYVAR-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O3 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 9-methoxyindolo[2,1-b]quinazoline-6,12-dione |
| InChIKey | DRPLTQKGAWYVAR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C3=NC4=CC=CC=C4C(=O)N23 |
Computed by PubChem (NCBI)