CAS 55294-87-6 is the registry number for 2-(3-Oxo-1,3-dihydroisobenzofuran-1-yl)phthalazin-1(2H)-one. Offered by: TRC. Available pack sizes: 250mg.
2-(3-oxo-1H-2-benzofuran-1-yl)phthalazin-1-one (CAS 55294-87-6) is a chemical compound with the molecular formula C16H10N2O3 and a molecular weight of 278.26 g/mol. IUPAC name: 2-(3-oxo-1H-2-benzofuran-1-yl)phthalazin-1-one. InChIKey: LZRPGFXKXJHZIR-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O3 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 2-(3-oxo-1H-2-benzofuran-1-yl)phthalazin-1-one |
| InChIKey | LZRPGFXKXJHZIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN(C2=O)C3C4=CC=CC=C4C(=O)O3 |
Computed by PubChem (NCBI)