CAS 101225-88-1 appears in our catalog under these names: 2-[3-(1H-1,2,4-Triazol-1-yl)propyl]-1h-isoindole-1,3(2h)-dione, 95%, 2-(3-(1H-1,2,4-TRiazol-1-yl)propyl)-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g.
2-[3-(1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione (CAS 101225-88-1) is a chemical compound with the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. IUPAC name: 2-[3-(1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione. InChIKey: OTWQARFFJWPPCW-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2-[3-(1,2,4-triazol-1-yl)propyl]isoindole-1,3-dione |
| InChIKey | OTWQARFFJWPPCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCN3C=NC=N3 |
Computed by PubChem (NCBI)