Products 685830-13-1
CAS 685830-13-1 is the registry number for 5-Methyl-N-(1-methyl-1H-indazol-3-yl)isoxazole-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-N-(1-methylindazol-3-yl)-1,2-oxazole-3-carboxamide (CAS 685830-13-1) is a chemical compound with the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. IUPAC name: 5-methyl-N-(1-methylindazol-3-yl)-1,2-oxazole-3-carboxamide. InChIKey: WPMMUXPTCRUHSY-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 5-methyl-N-(1-methylindazol-3-yl)-1,2-oxazole-3-carboxamide |
| InChIKey | WPMMUXPTCRUHSY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)C(=O)NC2=NN(C3=CC=CC=C32)C |
Computed by PubChem (NCBI)