CAS 400737-71-5 is the registry number for 1-(2-Phenoxyethyl)-1H-pyrazolo(3,4-d)pyrimidin-4-ol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(2-phenoxyethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 400737-71-5) is a chemical compound with the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. IUPAC name: 1-(2-phenoxyethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: FIOIWWCELKTCMD-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 1-(2-phenoxyethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | FIOIWWCELKTCMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCN2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)