CAS 1260934-79-9 is the registry number for 6-(3-P-Tolyl-[1,2,4]oxadiazol-5-yl)-4,5-dihydro-2h-pyridazin-3-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4,5-dihydro-1H-pyridazin-6-one (CAS 1260934-79-9) is a chemical compound with the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. IUPAC name: 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4,5-dihydro-1H-pyridazin-6-one. InChIKey: DITDKHRHBLRGGM-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | DITDKHRHBLRGGM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)C3=NNC(=O)CC3 |
Computed by PubChem (NCBI)