CAS 961-45-5 appears in our catalog under these names: 1,3-Dimethyl-8-phenylxanthine, >95% (HPLC), 8-Phenyltheophylline, 1,3-Dimethyl-8-phenylxanthine, ≥95%, ≥95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 100mg, 50mg, 1g, 2g, 5g, 25mg.
1,3-dimethyl-8-phenyl-7H-purine-2,6-dione (CAS 961-45-5) is a chemical compound with the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. IUPAC name: 1,3-dimethyl-8-phenyl-7H-purine-2,6-dione. InChIKey: PJFMAVHETLRJHJ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 1,3-dimethyl-8-phenyl-7H-purine-2,6-dione |
| InChIKey | PJFMAVHETLRJHJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)