CAS 1583282-89-6 is the registry number for (S)-2-Amino-4-methyl-N-phenethylpentanamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-4-methyl-N-(2-phenylethyl)pentanamide;hydrochloride (CAS 1583282-89-6) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: (2S)-2-amino-4-methyl-N-(2-phenylethyl)pentanamide;hydrochloride. InChIKey: JBMNXMUJIYQICQ-ZOWNYOTGSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 270.80 g/mol |
| IUPAC name | (2S)-2-amino-4-methyl-N-(2-phenylethyl)pentanamide;hydrochloride |
| InChIKey | JBMNXMUJIYQICQ-ZOWNYOTGSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)