Products 1013-68-9
CAS 1013-68-9 is the registry number for 3-(3-Chlorophenyl)-1,3-thiazolidine-2,4-dione, 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione (CAS 1013-68-9) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione. InChIKey: ZUKHMYVMHSQCEL-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| InChIKey | ZUKHMYVMHSQCEL-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)