Products 10134-95-9
CAS 10134-95-9 appears in our catalog under these names: Benzo[b]thiophene-4-carboxylic acid, 98%, Benzo[b]thiophene-4-carboxylic acid 98%, Benzo[b]thiophene-4-carboxylic acid, 98%, 98%, Benzo[b]thiophene-4-carboxylic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 1g, 5g, 250mg.
1-benzothiophene-4-carboxylic acid (CAS 10134-95-9) is a chemical compound with the molecular formula C9H6O2S and a molecular weight of 178.21 g/mol. IUPAC name: 1-benzothiophene-4-carboxylic acid. InChIKey: REVHWEJAHDLSTJ-UHFFFAOYSA-N.
| Molecular formula | C9H6O2S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1-benzothiophene-4-carboxylic acid |
| InChIKey | REVHWEJAHDLSTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CSC2=C1)C(=O)O |
Computed by PubChem (NCBI)