Products 2060-64-2
CAS 2060-64-2 appears in our catalog under these names: 1-Benzothiophene-5-carboxylic acid, 95% , Benzo[b]thiophene-5-carboxylic acid 97%, Benzo[b]thiophene-5-carboxylic acid, 99%, 99%, Benzo[b]thiophene-5-carboxylic acid, 95%. Offered by: Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 250MG, 1g, 5g, 25g, 50mg, 100mg, 10g.
1-benzothiophene-5-carboxylic acid (CAS 2060-64-2) is a chemical compound with the molecular formula C9H6O2S and a molecular weight of 178.21 g/mol. IUPAC name: 1-benzothiophene-5-carboxylic acid. InChIKey: SNBYTKLWZRHESA-UHFFFAOYSA-N.
| Molecular formula | C9H6O2S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1-benzothiophene-5-carboxylic acid |
| InChIKey | SNBYTKLWZRHESA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CS2)C=C1C(=O)O |
Computed by PubChem (NCBI)