CAS 107514-60-3 appears in our catalog under these names: 2-Hydroxy-4H-thiochromen-4-one, 98%, 2-Hydroxy-4H-1-benzothiopyran-4-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
2-hydroxythiochromen-4-one (CAS 107514-60-3) is a chemical compound with the molecular formula C9H6O2S and a molecular weight of 178.21 g/mol. IUPAC name: 2-hydroxythiochromen-4-one. InChIKey: OSIDMAJZERBPOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6O2S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-hydroxythiochromen-4-one |
| InChIKey | OSIDMAJZERBPOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(S2)O |
Computed by PubChem (NCBI)