Products 6179-26-6
CAS 6179-26-6 appears in our catalog under these names: 1-Benzothiophene-6-carboxylic acid, 1-Benzothiophene-6-carboxylic acid, 97%, Benzo[b]thiophene-6-carboxylic acid 95%, Benzo[b]thiophene-6-carboxylic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
1-benzothiophene-6-carboxylic acid (CAS 6179-26-6) is a chemical compound with the molecular formula C9H6O2S and a molecular weight of 178.21 g/mol. IUPAC name: 1-benzothiophene-6-carboxylic acid. InChIKey: VMGLLMDIYIPVHX-UHFFFAOYSA-N.
| Molecular formula | C9H6O2S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1-benzothiophene-6-carboxylic acid |
| InChIKey | VMGLLMDIYIPVHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CS2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Benzothiophene-6-carboxylic acid, benzo[b]thiophene-6-carboxylic acid, benzothiophene-6-carboxylic acid, Benzo(b)thiophene-6-carboxylic acid, 6-carboxybenzothiophene, 6-Benzothiophenecarboxylic acid, benzo[b]thiophene-6-carboxylicacid, 1-Benzothiophene-6-carboxylic acid #, benzothiophene-6-carboxylic acid - [B87098]