Products 10134-98-2
CAS 10134-98-2 appears in our catalog under these names: Benzo[b]thiophene-7-carboxylic acid, 98%, 98%, Benzo(b)thiophene-7-carboxylic acid, 98%, Benzo[b]thiophene-7-carboxylic acid, 98%, Benzo[b]thiophene-7-carboxylic acid, 95%, Benzo(b)thiophene-7-carboxylic acid. Offered by: Chemat, AmBeed, Fluorochem, Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-benzothiophene-7-carboxylic acid (CAS 10134-98-2) is a chemical compound with the molecular formula C9H6O2S and a molecular weight of 178.21 g/mol. IUPAC name: 1-benzothiophene-7-carboxylic acid. InChIKey: LJPSRTWIAXVPIS-UHFFFAOYSA-N.
| Molecular formula | C9H6O2S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1-benzothiophene-7-carboxylic acid |
| InChIKey | LJPSRTWIAXVPIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)SC=C2 |
Computed by PubChem (NCBI)