CAS 101351-09-1 appears in our catalog under these names: 2-(2-(4-Aminophenoxy)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione, 2-(2-(4-Aminophenoxy)ethyl)isoindoline-1,3-dione, 97%, 97%, 2-[2-(4-Aminophenoxy)ethyl]-1H-isoindole-1,3(2H)-dione, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 250mg, 1g.
2-[2-(4-aminophenoxy)ethyl]isoindole-1,3-dione (CAS 101351-09-1) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 2-[2-(4-aminophenoxy)ethyl]isoindole-1,3-dione. InChIKey: MWIHYGXYALYNNF-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-[2-(4-aminophenoxy)ethyl]isoindole-1,3-dione |
| InChIKey | MWIHYGXYALYNNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCOC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)