CAS 1013997-51-7 appears in our catalog under these names: (S)-3-(1-Fmoc-pyrrolidin-2-yl)-propionic acid, 95%, (S)-3-(1-(((9H-Fluoren-9-yl)methoxy)carbonyl)pyrrolidin-2-yl)propanoic acid, 95+%, (S)-3-(1-Fmoc-pyrrolidin-2-yl)-propionic acid. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidin-2-yl]propanoic acid (CAS 1013997-51-7) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 3-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidin-2-yl]propanoic acid. InChIKey: IFUWGSCZSKIAIA-HNNXBMFYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 3-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidin-2-yl]propanoic acid |
| InChIKey | IFUWGSCZSKIAIA-HNNXBMFYSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CCC(=O)O |
Computed by PubChem (NCBI)