CAS 101421-79-8 appears in our catalog under these names: 5-Amino-4-hydroxybenzene-1,3-dicarboxylic acid, 95%, 5-Amino-4-hydroxybenzene-1,3-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-amino-4-hydroxybenzene-1,3-dicarboxylic acid (CAS 101421-79-8) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 5-amino-4-hydroxybenzene-1,3-dicarboxylic acid. InChIKey: NRLAHLDJPVUAFP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 5-amino-4-hydroxybenzene-1,3-dicarboxylic acid |
| InChIKey | NRLAHLDJPVUAFP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)N)C(=O)O |
Computed by PubChem (NCBI)