CAS 1014630-04-6 is the registry number for 5-(Pyridin-3-yl)-1,3,4-thiadiazole-2-carboxylic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-pyridin-3-yl-1,3,4-thiadiazole-2-carboxylic acid (CAS 1014630-04-6) is a chemical compound with the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. IUPAC name: 5-pyridin-3-yl-1,3,4-thiadiazole-2-carboxylic acid. InChIKey: LTZAYBFDBMPLSV-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2S |
|---|---|
| Molecular weight | 207.21 g/mol |
| IUPAC name | 5-pyridin-3-yl-1,3,4-thiadiazole-2-carboxylic acid |
| InChIKey | LTZAYBFDBMPLSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN=C(S2)C(=O)O |
Computed by PubChem (NCBI)