Products 1014630-04-6

CAS 1014630-04-6 is the registry number for 5-(Pyridin-3-yl)-1,3,4-thiadiazole-2-carboxylic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-pyridin-3-yl-1,3,4-thiadiazole-2-carboxylic acid (CAS 1014630-04-6) is a chemical compound with the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. IUPAC name: 5-pyridin-3-yl-1,3,4-thiadiazole-2-carboxylic acid. InChIKey: LTZAYBFDBMPLSV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5N3O2S
Molecular weight207.21 g/mol
IUPAC name5-pyridin-3-yl-1,3,4-thiadiazole-2-carboxylic acid
InChIKeyLTZAYBFDBMPLSV-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)C2=NN=C(S2)C(=O)O

Computed by PubChem (NCBI)