Products 1014631-19-6
CAS 1014631-19-6 is the registry number for 2-(Pyridazin-3-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyridazin-3-yl-1,3-thiazole-4-carboxylic acid (CAS 1014631-19-6) is a chemical compound with the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. IUPAC name: 2-pyridazin-3-yl-1,3-thiazole-4-carboxylic acid. InChIKey: BXGYTTMAVKAANE-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2S |
|---|---|
| Molecular weight | 207.21 g/mol |
| IUPAC name | 2-pyridazin-3-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | BXGYTTMAVKAANE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)