Products 1014630-98-8

CAS 1014630-98-8 is the registry number for 2-(Pyrimidin-2-yl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid (CAS 1014630-98-8) is a chemical compound with the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. IUPAC name: 2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: LRXDMOYYUDZFCC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5N3O2S
Molecular weight207.21 g/mol
IUPAC name2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid
InChIKeyLRXDMOYYUDZFCC-UHFFFAOYSA-N
SMILESC1=CN=C(N=C1)C2=NC=C(S2)C(=O)O

Computed by PubChem (NCBI)