CAS 1014631-26-5 appears in our catalog under these names: 2-(Pyrimidin-2-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(Pyrimidin-2-yl)thiazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-pyrimidin-2-yl-1,3-thiazole-4-carboxylic acid (CAS 1014631-26-5) is a chemical compound with the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. IUPAC name: 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylic acid. InChIKey: JLEFSHGKRSIMSK-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2S |
|---|---|
| Molecular weight | 207.21 g/mol |
| IUPAC name | 2-pyrimidin-2-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | JLEFSHGKRSIMSK-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)